CAS 57187-42-5 is the registry number for N-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-dioxoisoindol-2-yl)-2-hydroxybenzamide (CAS 57187-42-5) is a chemical compound with the molecular formula C15H10N2O4 and a molecular weight of 282.25 g/mol. IUPAC name: N-(1,3-dioxoisoindol-2-yl)-2-hydroxybenzamide. InChIKey: MANIVYIOWWWTCT-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O4 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | N-(1,3-dioxoisoindol-2-yl)-2-hydroxybenzamide |
| InChIKey | MANIVYIOWWWTCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)NC(=O)C3=CC=CC=C3O |
Computed by PubChem (NCBI)