CAS 57236-57-4 appears in our catalog under these names: (R)-2-Methyl-1,2,3,4-tetrahydroisoquinoline-4,8-diol, 98%, Phenylephrine Impurity 6, Phenylephrine Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-2-methyl-3,4-dihydro-1H-isoquinoline-4,8-diol (CAS 57236-57-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (4R)-2-methyl-3,4-dihydro-1H-isoquinoline-4,8-diol. InChIKey: BVGIYKRHRXZGIO-JTQLQIEISA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (4R)-2-methyl-3,4-dihydro-1H-isoquinoline-4,8-diol |
| InChIKey | BVGIYKRHRXZGIO-JTQLQIEISA-N |
| SMILES | CN1C[C@@H](C2=C(C1)C(=CC=C2)O)O |
Computed by PubChem (NCBI)