Products 57238-81-0
CAS 57238-81-0 is the registry number for (4-Chlorophenyl)(piperazin-1-yl)methanone hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
(4-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 57238-81-0) is a chemical compound with the molecular formula C11H14Cl2N2O and a molecular weight of 261.14 g/mol. IUPAC name: (4-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: ZXJDUUIHTYUYAA-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2O |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (4-chlorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | ZXJDUUIHTYUYAA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)