CAS 57244-54-9 appears in our catalog under these names: 4,4'-(1,3,3-Trimethyl-1-propene-1,3-diyl)bisphenol, >95% (HPLC), 4,4-(1,3,3-Trimethyl-1-propene-1,3-diyl)bisphenol. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 10mg, 50mg.
4-[4-(4-hydroxyphenyl)-4-methylpent-2-en-2-yl]phenol (CAS 57244-54-9) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: 4-[4-(4-hydroxyphenyl)-4-methylpent-2-en-2-yl]phenol. InChIKey: GGWYYLOIWHKAJM-UHFFFAOYSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 4-[4-(4-hydroxyphenyl)-4-methylpent-2-en-2-yl]phenol |
| InChIKey | GGWYYLOIWHKAJM-UHFFFAOYSA-N |
| SMILES | CC(=CC(C)(C)C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)