Products 57250-87-0

CAS 57250-87-0 is the registry number for Ethyl 2-(ethylamino)-1,3-thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(ethylamino)-1,3-thiazole-4-carboxylate (CAS 57250-87-0) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: ethyl 2-(ethylamino)-1,3-thiazole-4-carboxylate. InChIKey: LBGHMAYKYDOTSC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O2S
Molecular weight200.26 g/mol
IUPAC nameethyl 2-(ethylamino)-1,3-thiazole-4-carboxylate
InChIKeyLBGHMAYKYDOTSC-UHFFFAOYSA-N
SMILESCCNC1=NC(=CS1)C(=O)OCC

Computed by PubChem (NCBI)