Products 5731-11-3
CAS 5731-11-3 appears in our catalog under these names: 4'-Bromo-[1,1'-biphenyl]-4-carboxylic acid, 95%, [1,1'-Biphenyl]-4'-bromo-4-carboxylic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g, 500mg.
4-(4-bromophenyl)benzoic acid (CAS 5731-11-3) is a chemical compound with the molecular formula C13H9BrO2 and a molecular weight of 277.11 g/mol. IUPAC name: 4-(4-bromophenyl)benzoic acid. InChIKey: UTHDVFIFIMWTJQ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO2 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | 4-(4-bromophenyl)benzoic acid |
| InChIKey | UTHDVFIFIMWTJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(4-bromophenyl)benzoic acid, 4'-bromo-[1,1'-biphenyl]-4-carboxylic acid, 4'-bromo[1,1'-biphenyl]-4-carboxylic acid, 4'-Bromo-4-biphenyl carboxylic acid, 4'-Bromo-biphenyl-4-carboxylic acid, 4-Biphenylcarboxylic acid, 4'-bromo-, [1,1'-Biphenyl]-4'-bromo-4-carboxylic acid, ChemDiv3_000181, 4'-bromobiphenyl-4-carboxylic acid, 4'-bromobiphenyl-4-c