CAS 57353-93-2 appears in our catalog under these names: 4-(4-Methoxyphenyl)-1,2-dihydrophthalazin-1-one, 95%, 4-(4-Methoxyphenyl)-1-(2H)-phthalazinone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g.
4-(4-methoxyphenyl)-2H-phthalazin-1-one (CAS 57353-93-2) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2H-phthalazin-1-one. InChIKey: RYLLTTFNKPGBNO-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-2H-phthalazin-1-one |
| InChIKey | RYLLTTFNKPGBNO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NNC(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)