CAS 57411-62-8 is the registry number for 1,3,4-Trimethyl-1H,6H,7H-pyrazolo(3,4-b)pyridin-6-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (CAS 57411-62-8) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one. InChIKey: CYLGJHAAHGAZHV-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| InChIKey | CYLGJHAAHGAZHV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C(=NN2C)C |
Computed by PubChem (NCBI)