CAS 57432-26-5 appears in our catalog under these names: 2-Methyl-4,4′-bipyridine, 95-<97%, 2-Methyl-4,4'-bipyridine, 95%, 95%, 2-Methyl-4,4'-bipyridine, 95%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g, 100mg.
2-methyl-4-pyridin-4-ylpyridine (CAS 57432-26-5) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-methyl-4-pyridin-4-ylpyridine. InChIKey: YQBPLVKHEZNFMQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-methyl-4-pyridin-4-ylpyridine |
| InChIKey | YQBPLVKHEZNFMQ-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)C2=CC=NC=C2 |
Computed by PubChem (NCBI)