CAS 5748-42-5 appears in our catalog under these names: 4–(4–tert–Butylphenyl)benzoic Acid, 4-(4-tert-Butylphenyl)benzoic Acid, >98.0%(GC)(T), 4-(4-T-butylphenyl)benzoic acid, 95%, 95%, 4'-(tert-Butyl)-[1,1'-biphenyl]-4-carboxylic acid, 98%, 4'-(tert-Butyl)-[1,1'-biphenyl]-4-carboxylic acid, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
4-(4-tert-butylphenyl)benzoic acid (CAS 5748-42-5) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 4-(4-tert-butylphenyl)benzoic acid. InChIKey: HZIOPONJCVOCFE-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)benzoic acid |
| InChIKey | HZIOPONJCVOCFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)