Products 57601-43-1
CAS 57601-43-1 is the registry number for 2-(Benzothiophene-2-carboxamido)acetic Acid, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(1-benzothiophene-2-carbonylamino)acetic acid (CAS 57601-43-1) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(1-benzothiophene-2-carbonylamino)acetic acid. InChIKey: RVAPFVNFENQBEB-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-(1-benzothiophene-2-carbonylamino)acetic acid |
| InChIKey | RVAPFVNFENQBEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)