Products 5773-98-8
CAS 5773-98-8 appears in our catalog under these names: 1-Aminonaphthalene-3-carboxylic acid, 96%, 4-Amino-2-naphthalenecarboxylicacid, 96%, 4-Amino-2-naphthoic acid, 96%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
4-aminonaphthalene-2-carboxylic acid (CAS 5773-98-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 4-aminonaphthalene-2-carboxylic acid. InChIKey: HLYLEARJBJRRTJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 4-aminonaphthalene-2-carboxylic acid |
| InChIKey | HLYLEARJBJRRTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2N)C(=O)O |
Computed by PubChem (NCBI)