CAS 57794-18-0 is the registry number for beta-D-Desosamine. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol (CAS 57794-18-0) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2R,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol. InChIKey: ZOYWWAGVGBSJDL-ULAWRXDQSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2R,3R,4S,6R)-4-(dimethylamino)-6-methyloxane-2,3-diol |
| InChIKey | ZOYWWAGVGBSJDL-ULAWRXDQSA-N |
| SMILES | C[C@@H]1C[C@@H]([C@H]([C@@H](O1)O)O)N(C)C |
Computed by PubChem (NCBI)