CAS 57798-00-2 appears in our catalog under these names: 8–Bromo–4–hydroxyquinoline, 8-Bromoquinoline-4-ol 97%, 8-Bromoquinoline-4-ol, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
8-bromo-1H-quinolin-4-one (CAS 57798-00-2) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromo-1H-quinolin-4-one. InChIKey: HLALMUWUZUGIGR-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromo-1H-quinolin-4-one |
| InChIKey | HLALMUWUZUGIGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=CC2=O |
Computed by PubChem (NCBI)