Products 578-29-0
CAS 578-29-0 appears in our catalog under these names: 1-(2,5-Dimethylfuran-3-yl)-4,4,4-trifluorobutane-1,3-dione, 95%, 1-(2,5-Dimethylfuran-3-yl)-4,4,4-trifluorobutane-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(2,5-dimethylfuran-3-yl)-4,4,4-trifluorobutane-1,3-dione (CAS 578-29-0) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 1-(2,5-dimethylfuran-3-yl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: BHOMEGVDWHEJTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-(2,5-dimethylfuran-3-yl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | BHOMEGVDWHEJTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)