Products 57836-79-0

CAS 57836-79-0 is the registry number for N-(2-Ethyl-6-methylphenyl)alanine Methyl Ester. Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 2-(2-ethyl-6-methylanilino)propanoate (CAS 57836-79-0) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: methyl 2-(2-ethyl-6-methylanilino)propanoate. InChIKey: LRBSXVUHGCCJDT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO2
Molecular weight221.29 g/mol
IUPAC namemethyl 2-(2-ethyl-6-methylanilino)propanoate
InChIKeyLRBSXVUHGCCJDT-UHFFFAOYSA-N
SMILESCCC1=CC=CC(=C1NC(C)C(=O)OC)C

Computed by PubChem (NCBI)