CAS 5791-56-0 appears in our catalog under these names: 7-Bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazin-3-one, 7-Bromo-6-chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 95%, 95%, 7-Bromo-6-chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 90%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
7-bromo-6-chloro-4H-1,4-benzoxazin-3-one (CAS 5791-56-0) is a chemical compound with the molecular formula C8H5BrClNO2 and a molecular weight of 262.49 g/mol. IUPAC name: 7-bromo-6-chloro-4H-1,4-benzoxazin-3-one. InChIKey: JBSVOFXWZXRDFG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO2 |
|---|---|
| Molecular weight | 262.49 g/mol |
| IUPAC name | 7-bromo-6-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | JBSVOFXWZXRDFG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)Br)Cl |
Computed by PubChem (NCBI)