CAS 58042-96-9 appears in our catalog under these names: Phenobarbital EP Impurity B, Phenobarbital Impurity 2（Phenobarbital EP Impurity B）, 6-Amino-5-ethyl-5-phenyl-2,4(3H,5H)-pyrimidinedione, >95% (HPLC), 6-Amino-5-ethyl-5-phenyl-2,4(3H,5H)-pyrimidinedioneÂ. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
6-amino-5-ethyl-5-phenylpyrimidine-2,4-dione (CAS 58042-96-9) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 6-amino-5-ethyl-5-phenylpyrimidine-2,4-dione. InChIKey: HUYKEYWPDBRCSH-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 6-amino-5-ethyl-5-phenylpyrimidine-2,4-dione |
| InChIKey | HUYKEYWPDBRCSH-UHFFFAOYSA-N |
| SMILES | CCC1(C(=NC(=O)NC1=O)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)