CAS 58163-20-5 appears in our catalog under these names: 3-Chloro-6,7-dimethoxyisoquinoline, 97%, 3-Chloro-6,7-dimethoxyisoquinoline. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
3-chloro-6,7-dimethoxyisoquinoline (CAS 58163-20-5) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 3-chloro-6,7-dimethoxyisoquinoline. InChIKey: UHNYGOXREGUUGH-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 3-chloro-6,7-dimethoxyisoquinoline |
| InChIKey | UHNYGOXREGUUGH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NC(=CC2=C1)Cl)OC |
Computed by PubChem (NCBI)