Products 58177-53-0
CAS 58177-53-0 appears in our catalog under these names: (E)-2-Cyano-3-(thiophen-2-yl)acrylic acid, 95%, 2-CYANO-3-(THIOPHEN-2-YL)ACRYLIC ACID, 95%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(E)-2-cyano-3-thiophen-2-ylprop-2-enoic acid (CAS 58177-53-0) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: (E)-2-cyano-3-thiophen-2-ylprop-2-enoic acid. InChIKey: QYGBYAQGBVHMDD-GQCTYLIASA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | (E)-2-cyano-3-thiophen-2-ylprop-2-enoic acid |
| InChIKey | QYGBYAQGBVHMDD-GQCTYLIASA-N |
| SMILES | C1=CSC(=C1)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-cyano-3-(2-thienyl)acrylic acid, 2-Cyano-3-(thiophen-2-yl)acrylic acid, (E)-2-cyano-3-thiophen-2-ylprop-2-enoic acid, (E)-2-cyano-3-(thiophen-2-yl)acrylic acid, (2E)-2-cyano-3-(thiophen-2-yl)prop-2-enoic acid, 2-Cyano-3-(thiophen-2-yl)acrylicacid, (E)-2-Cyano-3-(2-thienyl)acrylic Acid, (E)-2-cyano-3-(2-thienyl)prop-2-enoic acid