CAS 677304-83-5 appears in our catalog under these names: Benzo[d]thiazole-7-carboxylic acid, 95%, 7-Benzothiazolecarboxylic Acid, Benzo[d]thiazole-7-carboxylic acid 96%, Benzo[d]thiazole-7-carboxylic acid, 97%, 97%, Benzo[d]thiazole-7-carboxylic acid, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,3-benzothiazole-7-carboxylic acid (CAS 677304-83-5) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,3-benzothiazole-7-carboxylic acid. InChIKey: ORSZGLLQNYSMNO-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 1,3-benzothiazole-7-carboxylic acid |
| InChIKey | ORSZGLLQNYSMNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=CS2)C(=O)O |
Computed by PubChem (NCBI)