Products 58259-29-3
CAS 58259-29-3 is the registry number for Benzyl(4-cyanophenyl)carbamic chloride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
N-benzyl-N-(4-cyanophenyl)carbamoyl chloride (CAS 58259-29-3) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: N-benzyl-N-(4-cyanophenyl)carbamoyl chloride. InChIKey: LJAQSNUMZIBUKK-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | N-benzyl-N-(4-cyanophenyl)carbamoyl chloride |
| InChIKey | LJAQSNUMZIBUKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=C(C=C2)C#N)C(=O)Cl |
Computed by PubChem (NCBI)