CAS 58259-34-0 appears in our catalog under these names: N-Butyl-4-nitroaniline, 97%, N–Butyl–4–nitroaniline, N-Butyl-4-nitroaniline, ≥97%, ≥97%, N-Butyl-4-nitroaniline, 98%+,RG. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
N-butyl-4-nitroaniline (CAS 58259-34-0) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N-butyl-4-nitroaniline. InChIKey: KCTYPOBEIDJYGF-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N-butyl-4-nitroaniline |
| InChIKey | KCTYPOBEIDJYGF-UHFFFAOYSA-N |
| SMILES | CCCCNC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)