CAS 58316-11-3 is the registry number for (2E)-3-(Dimethylamino)-1-(3-methoxyphenyl)prop-2-en-1-one, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
(E)-3-(dimethylamino)-1-(3-methoxyphenyl)prop-2-en-1-one (CAS 58316-11-3) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(3-methoxyphenyl)prop-2-en-1-one. InChIKey: QBMMITATXZJWDG-BQYQJAHWSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(3-methoxyphenyl)prop-2-en-1-one |
| InChIKey | QBMMITATXZJWDG-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)