CAS 58380-12-4 appears in our catalog under these names: 2-(2-Bromobenzyl)malonic acid, 95%, Propanedioic acid， 2–((2–bromophenyl)methyl)–. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 200mg.
2-[(2-bromophenyl)methyl]propanedioic acid (CAS 58380-12-4) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: 2-[(2-bromophenyl)methyl]propanedioic acid. InChIKey: VCSBDMWPFZZEHM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 2-[(2-bromophenyl)methyl]propanedioic acid |
| InChIKey | VCSBDMWPFZZEHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)