CAS 58486-00-3 appears in our catalog under these names: 1-Benzylpyrrolidine-2,3-dione, 95%, 1-Benzylpyrrolidine-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-benzylpyrrolidine-2,3-dione (CAS 58486-00-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1-benzylpyrrolidine-2,3-dione. InChIKey: SYXGGMOJCHZAAY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-benzylpyrrolidine-2,3-dione |
| InChIKey | SYXGGMOJCHZAAY-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)