Products 58555-21-8

CAS 58555-21-8 is the registry number for 3-(1H-Benzimidazol-1-yl)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(benzimidazol-1-yl)-2-methylpropanoic acid (CAS 58555-21-8) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(benzimidazol-1-yl)-2-methylpropanoic acid. InChIKey: NIIJKDXDTQPYOQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O2
Molecular weight204.22 g/mol
IUPAC name3-(benzimidazol-1-yl)-2-methylpropanoic acid
InChIKeyNIIJKDXDTQPYOQ-UHFFFAOYSA-N
SMILESCC(CN1C=NC2=CC=CC=C21)C(=O)O

Computed by PubChem (NCBI)