CAS 89717-84-0 is the registry number for cis-3,4-Di-p-anisyl-3-hexene-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 10 mg, 2.5 mg, 25 mg.
1-[(Z)-1,1,1,6,6,6-hexadeuterio-4-(4-methoxyphenyl)hex-3-en-3-yl]-4-methoxybenzene (CAS 89717-84-0) is a chemical compound with the molecular formula C20H24O2 and a molecular weight of 302.4 g/mol. IUPAC name: 1-[(Z)-1,1,1,6,6,6-hexadeuterio-4-(4-methoxyphenyl)hex-3-en-3-yl]-4-methoxybenzene. InChIKey: VQOAQMIKPYNCMV-HLYCMOFPSA-N.
| Molecular formula | C20H24O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 1-[(Z)-1,1,1,6,6,6-hexadeuterio-4-(4-methoxyphenyl)hex-3-en-3-yl]-4-methoxybenzene |
| InChIKey | VQOAQMIKPYNCMV-HLYCMOFPSA-N |
| SMILES | [2H]C([2H])([2H])C/C(=C(\CC([2H])([2H])[2H])/C1=CC=C(C=C1)OC)/C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)