CAS 58605-09-7 is the registry number for 4-Chloro-5,7-dimethoxyindolin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-5,7-dimethoxy-1,3-dihydroindol-2-one (CAS 58605-09-7) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 4-chloro-5,7-dimethoxy-1,3-dihydroindol-2-one. InChIKey: LSNBUFHDELVTSR-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | 4-chloro-5,7-dimethoxy-1,3-dihydroindol-2-one |
| InChIKey | LSNBUFHDELVTSR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=C1NC(=O)C2)Cl)OC |
Computed by PubChem (NCBI)