Products 58664-93-0
CAS 58664-93-0 appears in our catalog under these names: 3-(Carboxymethyl)-1-methyl-1h-indole-2-carboxylic acid, 95%, 3–(carboxymethyl)–1–methyl–1H–indole–2–carboxylic acid, 3-(carboxymethyl)-1-methyl-1H-indole-2-carboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
3-(carboxymethyl)-1-methylindole-2-carboxylic acid (CAS 58664-93-0) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 3-(carboxymethyl)-1-methylindole-2-carboxylic acid. InChIKey: JOKUEFCTYPOURQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 3-(carboxymethyl)-1-methylindole-2-carboxylic acid |
| InChIKey | JOKUEFCTYPOURQ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C1C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)