Products 58734-32-0
CAS 58734-32-0 appears in our catalog under these names: 8-Methyl-2-oxo-2H-chromene-3-carboxylic acid, 95-<97%, 8-Methyl-2-oxo-2H-chromene-3-carboxylic acid, ≥97-<99%, 8-Methyl-2-oxo-2H-chromene-3-carboxylic acid, 97%, 8-Methyl-2-oxo-2H-chromene-3-carboxylic acid, 98%. Offered by: Hoffman Fine Chemicals, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
8-methyl-2-oxochromene-3-carboxylic acid (CAS 58734-32-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 8-methyl-2-oxochromene-3-carboxylic acid. InChIKey: JGVTUAUTAMXVAF-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 8-methyl-2-oxochromene-3-carboxylic acid |
| InChIKey | JGVTUAUTAMXVAF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)