Products 58749-33-0
CAS 58749-33-0 appears in our catalog under these names: Dimethyl 3–bromophthalate, Dimethyl 3-bromophthalate 98%, Dimethyl 3-bromophthalate, 96%, 96%, DIMETHYL 3-BROMOPHTHALATE, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 500mg, 10g, 100g.
Dimethyl 3-bromobenzene-1,2-dicarboxylate (CAS 58749-33-0) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: dimethyl 3-bromobenzene-1,2-dicarboxylate. InChIKey: JRAPUXBKWPTMEQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | dimethyl 3-bromobenzene-1,2-dicarboxylate |
| InChIKey | JRAPUXBKWPTMEQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)