CAS 58868-03-4 is the registry number for 5,8-Dimethoxy-2-methylquinolin-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,8-dimethoxy-2-methyl-1H-quinolin-4-one (CAS 58868-03-4) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 5,8-dimethoxy-2-methyl-1H-quinolin-4-one. InChIKey: UACXXSYLUDAQFM-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5,8-dimethoxy-2-methyl-1H-quinolin-4-one |
| InChIKey | UACXXSYLUDAQFM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C=CC(=C2N1)OC)OC |
Computed by PubChem (NCBI)