CAS 58955-94-5 appears in our catalog under these names: cis-10,11-Dihydroxy-10,11-dihydrocarbamazepine, >95% (HPLC), Cis-10,11-dihydroxy-10,11-dihydrocarbamazepine. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg.
(5S,6R)-5,6-dihydroxy-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide (CAS 58955-94-5) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: (5S,6R)-5,6-dihydroxy-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide. InChIKey: PRGQOPPDPVELEG-OKILXGFUSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (5S,6R)-5,6-dihydroxy-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | PRGQOPPDPVELEG-OKILXGFUSA-N |
| SMILES | C1=CC=C2C(=C1)[C@@H]([C@@H](C3=CC=CC=C3N2C(=O)N)O)O |
Computed by PubChem (NCBI)