CAS 58970-19-7 appears in our catalog under these names: 4-Chloro-4'-methoxybiphenyl, 98%, 4-Chloro-4'-methoxy-1,1'-biphenyl, 98%, 98%, 4-Chloro-4'-methoxy-1,1'-biphenyl, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
1-chloro-4-(4-methoxyphenyl)benzene (CAS 58970-19-7) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 1-chloro-4-(4-methoxyphenyl)benzene. InChIKey: PUVSUQVVUYQOBK-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-chloro-4-(4-methoxyphenyl)benzene |
| InChIKey | PUVSUQVVUYQOBK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)