CAS 58973-41-4 appears in our catalog under these names: 3,3-Diphenylpropanohydrazide, 95%, 3,3-Diphenylpropanehydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3,3-diphenylpropanehydrazide (CAS 58973-41-4) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 3,3-diphenylpropanehydrazide. InChIKey: CHQPMMMDWSZFDN-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 3,3-diphenylpropanehydrazide |
| InChIKey | CHQPMMMDWSZFDN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)NN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)