Products 590391-00-7
CAS 590391-00-7 is the registry number for 2-(2,5-Dimethylphenyl)-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 10g.
2-(2,5-dimethylphenyl)-1H-indole-3-carbaldehyde (CAS 590391-00-7) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)-1H-indole-3-carbaldehyde. InChIKey: KXTKWYFVMVNZJZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)-1H-indole-3-carbaldehyde |
| InChIKey | KXTKWYFVMVNZJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=C(C3=CC=CC=C3N2)C=O |
Computed by PubChem (NCBI)