CAS 590417-56-4 appears in our catalog under these names: (1–Methyl–1H–indol–4–yl)boronic acid, (1-Methyl-1H-indol-4-yl)boronic acid, (1-Methyl-1H-indol-4-yl)boronic acid, 95-<97%, (1-Methyl-1H-indol-4-yl)boronic acid, ≥97-<99%, Boronic acid, B-(1-methyl-1H-indol-4-yl)-, 98+%, 98+%. Offered by: GLPBio, Biosynth, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 2,5g, 5g, 25g, 50g.
(1-methylindol-4-yl)boronic acid (CAS 590417-56-4) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: (1-methylindol-4-yl)boronic acid. InChIKey: GLLDFWAZHLTQLC-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | (1-methylindol-4-yl)boronic acid |
| InChIKey | GLLDFWAZHLTQLC-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN(C2=CC=C1)C)(O)O |
Computed by PubChem (NCBI)