CAS 590418-08-9 appears in our catalog under these names: 1–METHYLINDAZOL–5–BORONIC ACID, 1-Methyl-1H-indazol-5-yl-5-boronic acid 98%, (1-methyl-1H-indazol-5-yl)boronic acid, 98%, 98%, 1-Methyl-1H-indazol-5-yl-5-boronic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 250mg, 10g, 50g, 250g.
(1-methylindazol-5-yl)boronic acid (CAS 590418-08-9) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (1-methylindazol-5-yl)boronic acid. InChIKey: FPZFXDGMBDJLHR-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (1-methylindazol-5-yl)boronic acid |
| InChIKey | FPZFXDGMBDJLHR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(N=C2)C)(O)O |
Computed by PubChem (NCBI)