Products 59081-61-7
CAS 59081-61-7 appears in our catalog under these names: 2-Methyl-n-phenylalanine, 95%, 2-methyl-N-phenylalanine, >95% (HPLC), 2-Methyl-2-(phenylamino)propanoic acid, 97%, 2-Methyl-2-(phenylamino)propanoic acid. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 100mg, 500mg, 10000mg, 5000mg.
2-anilino-2-methylpropanoic acid (CAS 59081-61-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-anilino-2-methylpropanoic acid. InChIKey: VPCYMDCQKGJWDO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-anilino-2-methylpropanoic acid |
| InChIKey | VPCYMDCQKGJWDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)