CAS 59549-48-3 is the registry number for Ethyl 4,7-dimethyl-1H-indole-2-carboxylate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4,7-dimethyl-1H-indole-2-carboxylate (CAS 59549-48-3) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: ethyl 4,7-dimethyl-1H-indole-2-carboxylate. InChIKey: IMTWCOLMLKHDJT-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | ethyl 4,7-dimethyl-1H-indole-2-carboxylate |
| InChIKey | IMTWCOLMLKHDJT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2N1)C)C |
Computed by PubChem (NCBI)