CAS 59587-30-3 appears in our catalog under these names: Ethyl 6-hydroxybenzo(d)thiazole-2-carboxylate, 95+%, 2–Benzothiazolecarboxylicacid,6–hydroxy–,ethylester(9CI), Ethyl 6-hydroxy-1,3-benzothiazole-2-carboxylate. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 2,5g.
Ethyl 6-hydroxy-1,3-benzothiazole-2-carboxylate (CAS 59587-30-3) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: ethyl 6-hydroxy-1,3-benzothiazole-2-carboxylate. InChIKey: NKWMUUYSJMDDID-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | ethyl 6-hydroxy-1,3-benzothiazole-2-carboxylate |
| InChIKey | NKWMUUYSJMDDID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(S1)C=C(C=C2)O |
Computed by PubChem (NCBI)