CAS 5965-49-1 is the registry number for Ketobemidone hydrochloride. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(3-hydroxyphenyl)-1-methylpiperidin-4-yl]propan-1-one;hydrochloride (CAS 5965-49-1) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. IUPAC name: 1-[4-(3-hydroxyphenyl)-1-methylpiperidin-4-yl]propan-1-one;hydrochloride. InChIKey: HYDFAZFVKRXNJX-UHFFFAOYSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 283.79 g/mol |
| IUPAC name | 1-[4-(3-hydroxyphenyl)-1-methylpiperidin-4-yl]propan-1-one;hydrochloride |
| InChIKey | HYDFAZFVKRXNJX-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1(CCN(CC1)C)C2=CC(=CC=C2)O.Cl |
Computed by PubChem (NCBI)