Products 59663-66-0
CAS 59663-66-0 appears in our catalog under these names: 4-(1,3,4-Oxadiazol-2-yl)benzoic acid, 95%, 4-(1,3,4-Oxadiazol-2-yl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g.
4-(1,3,4-oxadiazol-2-yl)benzoic acid (CAS 59663-66-0) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 4-(1,3,4-oxadiazol-2-yl)benzoic acid. InChIKey: IZTWSORAYAOGDE-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 4-(1,3,4-oxadiazol-2-yl)benzoic acid |
| InChIKey | IZTWSORAYAOGDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=CO2)C(=O)O |
Computed by PubChem (NCBI)