Products 65870-52-2
CAS 65870-52-2 appears in our catalog under these names: delta4-Cephalexin Diketopiperazine (Technical Grade), delta4-Cephalexin ciketopiperazine(technical grade). Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 2mg.
2-(3,6-dioxo-5-phenylpiperazin-2-yl)-5-methyl-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid (CAS 65870-52-2) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: 2-(3,6-dioxo-5-phenylpiperazin-2-yl)-5-methyl-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid. InChIKey: NOPWEGGWWFOKMQ-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 2-(3,6-dioxo-5-phenylpiperazin-2-yl)-5-methyl-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
| InChIKey | NOPWEGGWWFOKMQ-UHFFFAOYSA-N |
| SMILES | CC1CSC(N=C1C(=O)O)C2C(=O)NC(C(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)