Products 59953-93-4
CAS 59953-93-4 is the registry number for (2E)-3-(4-(Prop-2-en-1-yloxy)phenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid (CAS 59953-93-4) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid. InChIKey: BDQXWLNXUBMIEG-VMPITWQZSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid |
| InChIKey | BDQXWLNXUBMIEG-VMPITWQZSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-[4-(prop-2-en-1-yloxy)phenyl]prop-2-enoic acid, 3-(4-(prop-2-en-1-yloxy)phenyl)prop-2-enoic acid, (2E)-3-(4-(prop-2-en-1-yloxy)phenyl)prop-2-enoic acid, (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid, (2E)-3-[4-(allyloxy)phenyl]acrylic acid, (E)-3-(4-(Allyloxy)phenyl)acrylic acid, 3-(4-(Allyloxy)phenyl)acrylic acid, 2-Propenoic acid, 3-[4-(2-propenyloxy)phenyl]-