CAS 5996-17-8 appears in our catalog under these names: D–Glucose 6–phosphate (dipotassium salt), D-GLUCOSE 6-PHOSPHATE DIPOTASSIUM &, Potassium (2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl phosphate, Dipotassium glucose-6-phosphate, 98%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 5G, Get quote.
Dipotassium;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate (CAS 5996-17-8) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. IUPAC name: dipotassium;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate. InChIKey: BWHWCIODKVRLNE-FAOVPRGRSA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | dipotassium;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] phosphate |
| InChIKey | BWHWCIODKVRLNE-FAOVPRGRSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)OP(=O)([O-])[O-].[K+].[K+] |
Computed by PubChem (NCBI)