CAS 60-45-7 appears in our catalog under these names: Fenimide, >95% (HPLC), Fenimide, Fenimide 97%, 4-Ethyl-3-methyl-3-phenylpyrrolidine-2,5-dione, 97%, 97%. Offered by: TRC, LoGiCal, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 1g, Get quote.
4-ethyl-3-methyl-3-phenylpyrrolidine-2,5-dione (CAS 60-45-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 4-ethyl-3-methyl-3-phenylpyrrolidine-2,5-dione. InChIKey: WYOMHOATUARGQV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 4-ethyl-3-methyl-3-phenylpyrrolidine-2,5-dione |
| InChIKey | WYOMHOATUARGQV-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC(=O)C1(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)