CAS 60034-86-8 is the registry number for 4-Methoxy-N,3-dimethylbenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-N,3-dimethylbenzamide (CAS 60034-86-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-methoxy-N,3-dimethylbenzamide. InChIKey: JMALYROPDSWWFL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-methoxy-N,3-dimethylbenzamide |
| InChIKey | JMALYROPDSWWFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NC)OC |
Computed by PubChem (NCBI)