Products 60132-35-6
CAS 60132-35-6 is the registry number for Pterodondiol. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
(1S,4aS,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol (CAS 60132-35-6) is a chemical compound with the molecular formula C15H28O2 and a molecular weight of 240.38 g/mol. IUPAC name: (1S,4aS,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol. InChIKey: LKKDASYGWYYFIK-DHMWGJHJSA-N.
| Molecular formula | C15H28O2 |
|---|---|
| Molecular weight | 240.38 g/mol |
| IUPAC name | (1S,4aS,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol |
| InChIKey | LKKDASYGWYYFIK-DHMWGJHJSA-N |
| SMILES | C[C@@]12CCC[C@]([C@H]1C[C@@H](CC2)C(C)(C)O)(C)O |
Computed by PubChem (NCBI)